C9H9ClN4 — CID 63090210
3-chloro-N-methyl-2-(1,2,4-triazol-1-yl)aniline (PubChem CID 63090210) has the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. Its IUPAC name is 3-chloro-N-methyl-2-(1,2,4-triazol-1-yl)aniline.
| Compound Name | 3-chloro-N-methyl-2-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 63090210 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 3-chloro-N-methyl-2-(1,2,4-triazol-1-yl)aniline |
| SMILES | CNc1cccc(Cl)c1-n1cncn1 |
| InChI | InChI=1S/C9H9ClN4/c1-11-8-4-2-3-7(10)9(8)14-6-12-5-13-14/h2-6,11H,1H3 |
| InChIKey | RYMGKEZGRYXYOT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |