C15H15ClN4O — CID 62633988
3-chloro-N-[1-(furan-2-yl)propyl]-2-(1,2,4-triazol-1-yl)aniline (PubChem CID 62633988) has the molecular formula C15H15ClN4O and a molecular weight of 302.76 g/mol. Its IUPAC name is 3-chloro-N-[1-(furan-2-yl)propyl]-2-(1,2,4-triazol-1-yl)aniline.
| Compound Name | 3-chloro-N-[1-(furan-2-yl)propyl]-2-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 62633988 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3-chloro-N-[1-(furan-2-yl)propyl]-2-(1,2,4-triazol-1-yl)aniline |
| SMILES | CCC(Nc1cccc(Cl)c1-n1cncn1)c1ccco1 |
| InChI | InChI=1S/C15H15ClN4O/c1-2-12(14-7-4-8-21-14)19-13-6-3-5-11(16)15(13)20-10-17-9-18-20/h3-10,12,19H,2H2,1H3 |
| InChIKey | AGDRTRDHAZYDQO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |