C13H18N4S — CID 103087546
N-(4-methylsulfanylbutyl)-2-(1,2,4-triazol-1-yl)aniline (PubChem CID 103087546) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is N-(4-methylsulfanylbutyl)-2-(1,2,4-triazol-1-yl)aniline.
| Compound Name | N-(4-methylsulfanylbutyl)-2-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 103087546 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(4-methylsulfanylbutyl)-2-(1,2,4-triazol-1-yl)aniline |
| SMILES | CSCCCCNc1ccccc1-n1cncn1 |
| InChI | InChI=1S/C13H18N4S/c1-18-9-5-4-8-15-12-6-2-3-7-13(12)17-11-14-10-16-17/h2-3,6-7,10-11,15H,4-5,8-9H2,1H3 |
| InChIKey | ANTLAWQXSLTOBY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|