C13H11N5O3 — CID 43784440
N-[(5-nitrofuran-2-yl)methyl]-2-(1,2,4-triazol-1-yl)aniline (PubChem CID 43784440) has the molecular formula C13H11N5O3 and a molecular weight of 285.26 g/mol. Its IUPAC name is N-[(5-nitrofuran-2-yl)methyl]-2-(1,2,4-triazol-1-yl)aniline.
| Compound Name | N-[(5-nitrofuran-2-yl)methyl]-2-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 43784440 |
| Molecular Formula | C13H11N5O3 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-[(5-nitrofuran-2-yl)methyl]-2-(1,2,4-triazol-1-yl)aniline |
| SMILES | O=[N+]([O-])c1ccc(CNc2ccccc2-n2cncn2)o1 |
| InChI | InChI=1S/C13H11N5O3/c19-18(20)13-6-5-10(21-13)7-15-11-3-1-2-4-12(11)17-9-14-8-16-17/h1-6,8-9,15H,7H2 |
| InChIKey | CXWCICSGVOKOGO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|