C13H10Br2N4O — CID 62083593
N-[(4,5-dibromofuran-2-yl)methyl]-2-(1,2,4-triazol-1-yl)aniline (PubChem CID 62083593) has the molecular formula C13H10Br2N4O and a molecular weight of 398.06 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methyl]-2-(1,2,4-triazol-1-yl)aniline.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methyl]-2-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 62083593 |
| Molecular Formula | C13H10Br2N4O |
| Molecular Weight | 398.06 g/mol |
| Exact Mass | 395.92 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methyl]-2-(1,2,4-triazol-1-yl)aniline |
| SMILES | Brc1cc(CNc2ccccc2-n2cncn2)oc1Br |
| InChI | InChI=1S/C13H10Br2N4O/c14-10-5-9(20-13(10)15)6-17-11-3-1-2-4-12(11)19-8-16-7-18-19/h1-5,7-8,17H,6H2 |
| InChIKey | LUQISLRFMRVPDR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.06 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |