C14H14N4O2 — CID 64580527
[5-[[2-(1,2,4-triazol-1-yl)anilino]methyl]furan-2-yl]methanol (PubChem CID 64580527) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is [5-[[2-(1,2,4-triazol-1-yl)anilino]methyl]furan-2-yl]methanol.
| Compound Name | [5-[[2-(1,2,4-triazol-1-yl)anilino]methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 64580527 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | [5-[[2-(1,2,4-triazol-1-yl)anilino]methyl]furan-2-yl]methanol |
| SMILES | OCc1ccc(CNc2ccccc2-n2cncn2)o1 |
| InChI | InChI=1S/C14H14N4O2/c19-8-12-6-5-11(20-12)7-16-13-3-1-2-4-14(13)18-10-15-9-17-18/h1-6,9-10,16,19H,7-8H2 |
| InChIKey | YXIBTURTENRRCA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |