C13H17ClINS — CID 79958215
N-(2-chloro-4-iodophenyl)-5,5-dimethylthian-3-amine (PubChem CID 79958215) has the molecular formula C13H17ClINS and a molecular weight of 381.71 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-5,5-dimethylthian-3-amine.
| Compound Name | N-(2-chloro-4-iodophenyl)-5,5-dimethylthian-3-amine |
|---|---|
| PubChem CID | 79958215 |
| Molecular Formula | C13H17ClINS |
| Molecular Weight | 381.71 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-5,5-dimethylthian-3-amine |
| SMILES | CC1(C)CSCC(Nc2ccc(I)cc2Cl)C1 |
| InChI | InChI=1S/C13H17ClINS/c1-13(2)6-10(7-17-8-13)16-12-4-3-9(15)5-11(12)14/h3-5,10,16H,6-8H2,1-2H3 |
| InChIKey | UXYREOGFIAIAEZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.71 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|