C18H28N2S — CID 79953476
5,5-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)thian-3-amine (PubChem CID 79953476) has the molecular formula C18H28N2S and a molecular weight of 304.50 g/mol. Its IUPAC name is 5,5-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)thian-3-amine.
| Compound Name | 5,5-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)thian-3-amine |
|---|---|
| PubChem CID | 79953476 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 5,5-dimethyl-N-(2-methyl-4-pyrrolidin-1-ylphenyl)thian-3-amine |
| SMILES | Cc1cc(N2CCCC2)ccc1NC1CSCC(C)(C)C1 |
| InChI | InChI=1S/C18H28N2S/c1-14-10-16(20-8-4-5-9-20)6-7-17(14)19-15-11-18(2,3)13-21-12-15/h6-7,10,15,19H,4-5,8-9,11-13H2,1-3H3 |
| InChIKey | AYSHIOBWIUEJEP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|