C17H25FN2O — CID 65083100
N-[5-[(4,4-dimethylcycloheptyl)amino]-2-fluorophenyl]acetamide (PubChem CID 65083100) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is N-[5-[(4,4-dimethylcycloheptyl)amino]-2-fluorophenyl]acetamide.
| Compound Name | N-[5-[(4,4-dimethylcycloheptyl)amino]-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 65083100 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | N-[5-[(4,4-dimethylcycloheptyl)amino]-2-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(NC2CCCC(C)(C)CC2)ccc1F |
| InChI | InChI=1S/C17H25FN2O/c1-12(21)19-16-11-14(6-7-15(16)18)20-13-5-4-9-17(2,3)10-8-13/h6-7,11,13,20H,4-5,8-10H2,1-3H3,(H,19,21) |
| InChIKey | QYFBMOZYBORGDK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |