C16H22FNO2 — CID 65084402
5-[(4,4-dimethylcycloheptyl)amino]-2-fluorobenzoic acid (PubChem CID 65084402) has the molecular formula C16H22FNO2 and a molecular weight of 279.36 g/mol. Its IUPAC name is 5-[(4,4-dimethylcycloheptyl)amino]-2-fluorobenzoic acid.
| Compound Name | 5-[(4,4-dimethylcycloheptyl)amino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 65084402 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 5-[(4,4-dimethylcycloheptyl)amino]-2-fluorobenzoic acid |
| SMILES | CC1(C)CCCC(Nc2ccc(F)c(C(=O)O)c2)CC1 |
| InChI | InChI=1S/C16H22FNO2/c1-16(2)8-3-4-11(7-9-16)18-12-5-6-14(17)13(10-12)15(19)20/h5-6,10-11,18H,3-4,7-9H2,1-2H3,(H,19,20) |
| InChIKey | KBRLSXDZZQLURF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |