4-[(4,4-dimethylcycloheptyl)amino]benzoic acid

C16H23NO2 — CID 65083920

IUPAC4-[(4,4-dimethylcycloheptyl)amino]benzoic acid
SMILESCC1(C)CCCC(Nc2ccc(C(=O)O)cc2)CC1
InChIInChI=1S/C16H23NO2/c1-16(2)10-3-4-13(9-11-16)17-14-7-5-12(6-8-14)15(18)19/h5-8,13,17H,3-4,9-11H2,1-2H3,(H,18,19)
InChIKeyILSSPYCRCILKHE-UHFFFAOYSA-N
MW261.37 g/mol
LogP4.16
Rot. Bonds3

About 4-[(4,4-dimethylcycloheptyl)amino]benzoic acid

4-[(4,4-dimethylcycloheptyl)amino]benzoic acid (PubChem CID 65083920) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 4-[(4,4-dimethylcycloheptyl)amino]benzoic acid.

Molecular Properties

Compound Name4-[(4,4-dimethylcycloheptyl)amino]benzoic acid
PubChem CID65083920
Molecular FormulaC16H23NO2
Molecular Weight261.37 g/mol
Exact Mass261.17
IUPAC Name4-[(4,4-dimethylcycloheptyl)amino]benzoic acid
SMILESCC1(C)CCCC(Nc2ccc(C(=O)O)cc2)CC1
InChIInChI=1S/C16H23NO2/c1-16(2)10-3-4-13(9-11-16)17-14-7-5-12(6-8-14)15(18)19/h5-8,13,17H,3-4,9-11H2,1-2H3,(H,18,19)
InChIKeyILSSPYCRCILKHE-UHFFFAOYSA-N
XLogP4.16
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.37
LogP ≤ 54.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-[(4,4-dimethylcycloheptyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(4,4-dimethylcycloheptyl)amino]benzoic acid?
The IUPAC name of 4-[(4,4-dimethylcycloheptyl)amino]benzoic acid (CID 65083920) is 4-[(4,4-dimethylcycloheptyl)amino]benzoic acid.
What is the SMILES notation for 4-[(4,4-dimethylcycloheptyl)amino]benzoic acid?
The canonical SMILES for 4-[(4,4-dimethylcycloheptyl)amino]benzoic acid is CC1(C)CCCC(Nc2ccc(C(=O)O)cc2)CC1.
What is the InChIKey of 4-[(4,4-dimethylcycloheptyl)amino]benzoic acid?
The InChIKey is ILSSPYCRCILKHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-16(2)10-3-4-13(9-11-16)17-14-7-5-12(6-8-14)15(18)19/h5-8,13,17H,3-4,9-11H2,1-2H3,(H,18,19).
What are the key properties of 4-[(4,4-dimethylcycloheptyl)amino]benzoic acid?
4-[(4,4-dimethylcycloheptyl)amino]benzoic acid has a molecular weight of 261.37 g/mol, XLogP of 4.16, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,4-dimethylcycloheptyl)amino]benzoic acid is sourced from PubChem (CID 65083920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).