C18H26N2O — CID 65083527
6-[(4,4-dimethylcycloheptyl)amino]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 65083527) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 6-[(4,4-dimethylcycloheptyl)amino]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[(4,4-dimethylcycloheptyl)amino]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 65083527 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 6-[(4,4-dimethylcycloheptyl)amino]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CC1(C)CCCC(Nc2ccc3c(c2)CCC(=O)N3)CC1 |
| InChI | InChI=1S/C18H26N2O/c1-18(2)10-3-4-14(9-11-18)19-15-6-7-16-13(12-15)5-8-17(21)20-16/h6-7,12,14,19H,3-5,8-11H2,1-2H3,(H,20,21) |
| InChIKey | QLNCJHMBKMJHON-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |