C13H16FNO3 — CID 82539355
2-fluoro-5-[(4-hydroxycyclohexyl)amino]benzoic acid (PubChem CID 82539355) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-fluoro-5-[(4-hydroxycyclohexyl)amino]benzoic acid.
| Compound Name | 2-fluoro-5-[(4-hydroxycyclohexyl)amino]benzoic acid |
|---|---|
| PubChem CID | 82539355 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-fluoro-5-[(4-hydroxycyclohexyl)amino]benzoic acid |
| SMILES | O=C(O)c1cc(NC2CCC(O)CC2)ccc1F |
| InChI | InChI=1S/C13H16FNO3/c14-12-6-3-9(7-11(12)13(17)18)15-8-1-4-10(16)5-2-8/h3,6-8,10,15-16H,1-2,4-5H2,(H,17,18) |
| InChIKey | XWZCTWRNEVBUCR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |