C12H14F2N2O2 — CID 123726968
4-(3,4-difluoroanilino)piperidine-1-carboxylic acid (PubChem CID 123726968) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 4-(3,4-difluoroanilino)piperidine-1-carboxylic acid.
| Compound Name | 4-(3,4-difluoroanilino)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 123726968 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-(3,4-difluoroanilino)piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(Nc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C12H14F2N2O2/c13-10-2-1-9(7-11(10)14)15-8-3-5-16(6-4-8)12(17)18/h1-2,7-8,15H,3-6H2,(H,17,18) |
| InChIKey | FSRJGGFPFYDVFS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |