C11H15N3O2 — CID 66738310
(3S)-3-(4-aminoanilino)pyrrolidine-1-carboxylic acid (PubChem CID 66738310) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is (3S)-3-(4-aminoanilino)pyrrolidine-1-carboxylic acid.
| Compound Name | (3S)-3-(4-aminoanilino)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66738310 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (3S)-3-(4-aminoanilino)pyrrolidine-1-carboxylic acid |
| SMILES | Nc1ccc(N[C@H]2CCN(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C11H15N3O2/c12-8-1-3-9(4-2-8)13-10-5-6-14(7-10)11(15)16/h1-4,10,13H,5-7,12H2,(H,15,16)/t10-/m0/s1 |
| InChIKey | DSUZZHHLIWMPIF-JTQLQIEISA-N |
| XLogP | 1.43 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|