C10H12ClN3O2 — CID 175114110
(3R)-3-[(5-chloro-2-pyridinyl)amino]pyrrolidine-1-carboxylic acid (PubChem CID 175114110) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is (3R)-3-[(5-chloro-2-pyridinyl)amino]pyrrolidine-1-carboxylic acid.
| Compound Name | (3R)-3-[(5-chloro-2-pyridinyl)amino]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175114110 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (3R)-3-[(5-chloro-2-pyridinyl)amino]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CC[C@@H](Nc2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C10H12ClN3O2/c11-7-1-2-9(12-5-7)13-8-3-4-14(6-8)10(15)16/h1-2,5,8H,3-4,6H2,(H,12,13)(H,15,16)/t8-/m1/s1 |
| InChIKey | JSDQCKWXWHAZGY-MRVPVSSYSA-N |
| XLogP | 1.90 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |