C19H19ClN4O3 — CID 142691795
N-(1-benzoylpiperidin-4-yl)-N'-(5-chloro-2-pyridinyl)oxamide (PubChem CID 142691795) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is N-(1-benzoylpiperidin-4-yl)-N'-(5-chloro-2-pyridinyl)oxamide.
| Compound Name | N-(1-benzoylpiperidin-4-yl)-N'-(5-chloro-2-pyridinyl)oxamide |
|---|---|
| PubChem CID | 142691795 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-(1-benzoylpiperidin-4-yl)-N'-(5-chloro-2-pyridinyl)oxamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)C(=O)NC1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H19ClN4O3/c20-14-6-7-16(21-12-14)23-18(26)17(25)22-15-8-10-24(11-9-15)19(27)13-4-2-1-3-5-13/h1-7,12,15H,8-11H2,(H,22,25)(H,21,23,26) |
| InChIKey | PKDVSAGIRBKNAT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|