C15H19ClN4O2 — CID 142691779
N'-(5-chloro-2-pyridinyl)-N-(1-cyclopropylpiperidin-4-yl)oxamide (PubChem CID 142691779) has the molecular formula C15H19ClN4O2 and a molecular weight of 322.80 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-N-(1-cyclopropylpiperidin-4-yl)oxamide.
| Compound Name | N'-(5-chloro-2-pyridinyl)-N-(1-cyclopropylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 142691779 |
| Molecular Formula | C15H19ClN4O2 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-N-(1-cyclopropylpiperidin-4-yl)oxamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)C(=O)NC1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C15H19ClN4O2/c16-10-1-4-13(17-9-10)19-15(22)14(21)18-11-5-7-20(8-6-11)12-2-3-12/h1,4,9,11-12H,2-3,5-8H2,(H,18,21)(H,17,19,22) |
| InChIKey | KDHWZXJKLPTTIR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|