C12H13ClN4O3 — CID 142691809
N'-(5-chloro-2-pyridinyl)-N-(2-oxopiperidin-4-yl)oxamide (PubChem CID 142691809) has the molecular formula C12H13ClN4O3 and a molecular weight of 296.71 g/mol. Its IUPAC name is N'-(5-chloro-2-pyridinyl)-N-(2-oxopiperidin-4-yl)oxamide.
| Compound Name | N'-(5-chloro-2-pyridinyl)-N-(2-oxopiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 142691809 |
| Molecular Formula | C12H13ClN4O3 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N'-(5-chloro-2-pyridinyl)-N-(2-oxopiperidin-4-yl)oxamide |
| SMILES | O=C1CC(NC(=O)C(=O)Nc2ccc(Cl)cn2)CCN1 |
| InChI | InChI=1S/C12H13ClN4O3/c13-7-1-2-9(15-6-7)17-12(20)11(19)16-8-3-4-14-10(18)5-8/h1-2,6,8H,3-5H2,(H,14,18)(H,16,19)(H,15,17,20) |
| InChIKey | OLSZPWXIHXLXKP-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|