C23H27ClN4O2S — CID 173199600
N-[2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-1-(thian-4-yl)piperidine-4-carboxamide (PubChem CID 173199600) has the molecular formula C23H27ClN4O2S and a molecular weight of 459.02 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-1-(thian-4-yl)piperidine-4-carboxamide.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-1-(thian-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 173199600 |
| Molecular Formula | C23H27ClN4O2S |
| Molecular Weight | 459.02 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-1-(thian-4-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)c1ccccc1NC(=O)C1CCN(C2CCSCC2)CC1 |
| InChI | InChI=1S/C23H27ClN4O2S/c24-17-5-6-21(25-15-17)27-23(30)19-3-1-2-4-20(19)26-22(29)16-7-11-28(12-8-16)18-9-13-31-14-10-18/h1-6,15-16,18H,7-14H2,(H,26,29)(H,25,27,30) |
| InChIKey | FSGDSWVRXYTWCY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.02 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |