C17H17Cl2N3O — CID 38952409
N-(2-chlorophenyl)-1-(5-chloro-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 38952409) has the molecular formula C17H17Cl2N3O and a molecular weight of 350.25 g/mol. Its IUPAC name is N-(2-chlorophenyl)-1-(5-chloro-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | N-(2-chlorophenyl)-1-(5-chloro-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38952409 |
| Molecular Formula | C17H17Cl2N3O |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N-(2-chlorophenyl)-1-(5-chloro-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)C1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C17H17Cl2N3O/c18-13-5-6-16(20-11-13)22-9-7-12(8-10-22)17(23)21-15-4-2-1-3-14(15)19/h1-6,11-12H,7-10H2,(H,21,23) |
| InChIKey | YSXNOQOHXUHUMV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |