C21H23ClN4O2 — CID 162690060
N-[4-[(3R)-3-[(5-chloro-2-pyridinyl)amino]pyrrolidine-1-carbonyl]phenyl]-2-methylidenebutanamide (PubChem CID 162690060) has the molecular formula C21H23ClN4O2 and a molecular weight of 398.89 g/mol. Its IUPAC name is N-[4-[(3R)-3-[(5-chloro-2-pyridinyl)amino]pyrrolidine-1-carbonyl]phenyl]-2-methylidenebutanamide.
| Compound Name | N-[4-[(3R)-3-[(5-chloro-2-pyridinyl)amino]pyrrolidine-1-carbonyl]phenyl]-2-methylidenebutanamide |
|---|---|
| PubChem CID | 162690060 |
| Molecular Formula | C21H23ClN4O2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[4-[(3R)-3-[(5-chloro-2-pyridinyl)amino]pyrrolidine-1-carbonyl]phenyl]-2-methylidenebutanamide |
| SMILES | C=C(CC)C(=O)Nc1ccc(C(=O)N2CC[C@@H](Nc3ccc(Cl)cn3)C2)cc1 |
| InChI | InChI=1S/C21H23ClN4O2/c1-3-14(2)20(27)25-17-7-4-15(5-8-17)21(28)26-11-10-18(13-26)24-19-9-6-16(22)12-23-19/h4-9,12,18H,2-3,10-11,13H2,1H3,(H,23,24)(H,25,27)/t18-/m1/s1 |
| InChIKey | DDLVJAVCHINLOV-GOSISDBHSA-N |
| XLogP | 3.97 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|