C17H18ClN5O3S — CID 153314230
N-[4-[3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]ethenesulfonamide (PubChem CID 153314230) has the molecular formula C17H18ClN5O3S and a molecular weight of 407.88 g/mol. Its IUPAC name is N-[4-[3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]ethenesulfonamide.
| Compound Name | N-[4-[3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]ethenesulfonamide |
|---|---|
| PubChem CID | 153314230 |
| Molecular Formula | C17H18ClN5O3S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-[4-[3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)Nc1ccc(C(=O)N2CCC(Nc3ncc(Cl)cn3)C2)cc1 |
| InChI | InChI=1S/C17H18ClN5O3S/c1-2-27(25,26)22-14-5-3-12(4-6-14)16(24)23-8-7-15(11-23)21-17-19-9-13(18)10-20-17/h2-6,9-10,15,22H,1,7-8,11H2,(H,19,20,21) |
| InChIKey | NPPHHOUDISHMQN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |