C21H21N5O3 — CID 153314025
N-[4-[(3R)-3-[(5-ethynyl-4-methoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide (PubChem CID 153314025) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[4-[(3R)-3-[(5-ethynyl-4-methoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[(3R)-3-[(5-ethynyl-4-methoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 153314025 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[4-[(3R)-3-[(5-ethynyl-4-methoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide |
| SMILES | C#Cc1cnc(N[C@@H]2CCN(C(=O)c3ccc(NC(=O)C=C)cc3)C2)nc1OC |
| InChI | InChI=1S/C21H21N5O3/c1-4-14-12-22-21(25-19(14)29-3)24-17-10-11-26(13-17)20(28)15-6-8-16(9-7-15)23-18(27)5-2/h1,5-9,12,17H,2,10-11,13H2,3H3,(H,23,27)(H,22,24,25)/t17-/m1/s1 |
| InChIKey | ZGFQKAOOQNDMTN-QGZVFWFLSA-N |
| XLogP | 1.92 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|