C25H31ClN6O3 — CID 147668383
(E)-N-[4-[(3R)-3-[(5-chloro-4-methoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]-4-piperidin-1-ylbut-2-enamide (PubChem CID 147668383) has the molecular formula C25H31ClN6O3 and a molecular weight of 499.02 g/mol. Its IUPAC name is (E)-N-[4-[(3R)-3-[(5-chloro-4-methoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]-4-piperidin-1-ylbut-2-enamide.
| Compound Name | (E)-N-[4-[(3R)-3-[(5-chloro-4-methoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]-4-piperidin-1-ylbut-2-enamide |
|---|---|
| PubChem CID | 147668383 |
| Molecular Formula | C25H31ClN6O3 |
| Molecular Weight | 499.02 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | (E)-N-[4-[(3R)-3-[(5-chloro-4-methoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]-4-piperidin-1-ylbut-2-enamide |
| SMILES | COc1nc(N[C@@H]2CCN(C(=O)c3ccc(NC(=O)/C=C/CN4CCCCC4)cc3)C2)ncc1Cl |
| InChI | InChI=1S/C25H31ClN6O3/c1-35-23-21(26)16-27-25(30-23)29-20-11-15-32(17-20)24(34)18-7-9-19(10-8-18)28-22(33)6-5-14-31-12-3-2-4-13-31/h5-10,16,20H,2-4,11-15,17H2,1H3,(H,28,33)(H,27,29,30)/b6-5+/t20-/m1/s1 |
| InChIKey | GMTFLFKNBWKDPY-RRFGBZISSA-N |
| XLogP | 3.45 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.02 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|