C20H22ClN5O3 — CID 153314257
N-[4-[3-[(5-chloro-4-ethoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide (PubChem CID 153314257) has the molecular formula C20H22ClN5O3 and a molecular weight of 415.88 g/mol. Its IUPAC name is N-[4-[3-[(5-chloro-4-ethoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[3-[(5-chloro-4-ethoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 153314257 |
| Molecular Formula | C20H22ClN5O3 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[4-[3-[(5-chloro-4-ethoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)N2CCC(Nc3ncc(Cl)c(OCC)n3)C2)cc1 |
| InChI | InChI=1S/C20H22ClN5O3/c1-3-17(27)23-14-7-5-13(6-8-14)19(28)26-10-9-15(12-26)24-20-22-11-16(21)18(25-20)29-4-2/h3,5-8,11,15H,1,4,9-10,12H2,2H3,(H,23,27)(H,22,24,25) |
| InChIKey | PFXZHCLSFRUVLY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|