C21H25ClN6O2 — CID 147643448
(E)-N-[4-[(3R)-3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]-4-(dimethylamino)but-2-enamide (PubChem CID 147643448) has the molecular formula C21H25ClN6O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is (E)-N-[4-[(3R)-3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | (E)-N-[4-[(3R)-3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 147643448 |
| Molecular Formula | C21H25ClN6O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (E)-N-[4-[(3R)-3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]phenyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C/C=C/C(=O)Nc1ccc(C(=O)N2CC[C@@H](Nc3ncc(Cl)cn3)C2)cc1 |
| InChI | InChI=1S/C21H25ClN6O2/c1-27(2)10-3-4-19(29)25-17-7-5-15(6-8-17)20(30)28-11-9-18(14-28)26-21-23-12-16(22)13-24-21/h3-8,12-13,18H,9-11,14H2,1-2H3,(H,25,29)(H,23,24,26)/b4-3+/t18-/m1/s1 |
| InChIKey | GIBUJKVPICWXCR-OAJJDEHYSA-N |
| XLogP | 2.51 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|