C19H21ClN6O3 — CID 147169460
(E)-N-[6-[(3R)-3-[(5-chloro-4-methoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]-3-pyridinyl]but-2-enamide (PubChem CID 147169460) has the molecular formula C19H21ClN6O3 and a molecular weight of 416.87 g/mol. Its IUPAC name is (E)-N-[6-[(3R)-3-[(5-chloro-4-methoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]-3-pyridinyl]but-2-enamide.
| Compound Name | (E)-N-[6-[(3R)-3-[(5-chloro-4-methoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]-3-pyridinyl]but-2-enamide |
|---|---|
| PubChem CID | 147169460 |
| Molecular Formula | C19H21ClN6O3 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (E)-N-[6-[(3R)-3-[(5-chloro-4-methoxypyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]-3-pyridinyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1ccc(C(=O)N2CC[C@@H](Nc3ncc(Cl)c(OC)n3)C2)nc1 |
| InChI | InChI=1S/C19H21ClN6O3/c1-3-4-16(27)23-12-5-6-15(21-9-12)18(28)26-8-7-13(11-26)24-19-22-10-14(20)17(25-19)29-2/h3-6,9-10,13H,7-8,11H2,1-2H3,(H,23,27)(H,22,24,25)/b4-3+/t13-/m1/s1 |
| InChIKey | BXLFDQKBLYJUDW-ITDFMYJTSA-N |
| XLogP | 2.37 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|