C22H24ClN5O4 — CID 175109645
N-[4-[3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]-2-(oxolan-3-yloxy)phenyl]prop-2-enamide (PubChem CID 175109645) has the molecular formula C22H24ClN5O4 and a molecular weight of 457.92 g/mol. Its IUPAC name is N-[4-[3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]-2-(oxolan-3-yloxy)phenyl]prop-2-enamide.
| Compound Name | N-[4-[3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]-2-(oxolan-3-yloxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175109645 |
| Molecular Formula | C22H24ClN5O4 |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | N-[4-[3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]-2-(oxolan-3-yloxy)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)N2CCC(Nc3ncc(Cl)cn3)C2)cc1OC1CCOC1 |
| InChI | InChI=1S/C22H24ClN5O4/c1-2-20(29)27-18-4-3-14(9-19(18)32-17-6-8-31-13-17)21(30)28-7-5-16(12-28)26-22-24-10-15(23)11-25-22/h2-4,9-11,16-17H,1,5-8,12-13H2,(H,27,29)(H,24,25,26) |
| InChIKey | MVPNCGHIJZPZTK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|