C15H21N3S — CID 79959114
N-(5,5-dimethylthian-3-yl)-2-methyl-3H-benzimidazol-5-amine (PubChem CID 79959114) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is N-(5,5-dimethylthian-3-yl)-2-methyl-3H-benzimidazol-5-amine.
| Compound Name | N-(5,5-dimethylthian-3-yl)-2-methyl-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 79959114 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-(5,5-dimethylthian-3-yl)-2-methyl-3H-benzimidazol-5-amine |
| SMILES | Cc1nc2ccc(NC3CSCC(C)(C)C3)cc2[nH]1 |
| InChI | InChI=1S/C15H21N3S/c1-10-16-13-5-4-11(6-14(13)17-10)18-12-7-15(2,3)9-19-8-12/h4-6,12,18H,7-9H2,1-3H3,(H,16,17) |
| InChIKey | IJYPHTAOPBTISD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |