C18H25FN4S — CID 22272900
2-(cyclohexylmethylsulfanyl)-6-fluoro-5-piperazin-1-yl-1H-benzimidazole (PubChem CID 22272900) has the molecular formula C18H25FN4S and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-(cyclohexylmethylsulfanyl)-6-fluoro-5-piperazin-1-yl-1H-benzimidazole.
| Compound Name | 2-(cyclohexylmethylsulfanyl)-6-fluoro-5-piperazin-1-yl-1H-benzimidazole |
|---|---|
| PubChem CID | 22272900 |
| Molecular Formula | C18H25FN4S |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-(cyclohexylmethylsulfanyl)-6-fluoro-5-piperazin-1-yl-1H-benzimidazole |
| SMILES | Fc1cc2[nH]c(SCC3CCCCC3)nc2cc1N1CCNCC1 |
| InChI | InChI=1S/C18H25FN4S/c19-14-10-15-16(11-17(14)23-8-6-20-7-9-23)22-18(21-15)24-12-13-4-2-1-3-5-13/h10-11,13,20H,1-9,12H2,(H,21,22) |
| InChIKey | MYHUXZBQBZDOSZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |