C36H56N2 — CID 118102539
2,2,6,6-tetramethyl-4-[3-[4-[4-[3-(2,2,6,6-tetramethylpiperidin-4-yl)propyl]phenyl]phenyl]propyl]piperidine (PubChem CID 118102539) has the molecular formula C36H56N2 and a molecular weight of 516.86 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-[3-[4-[4-[3-(2,2,6,6-tetramethylpiperidin-4-yl)propyl]phenyl]phenyl]propyl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-[3-[4-[4-[3-(2,2,6,6-tetramethylpiperidin-4-yl)propyl]phenyl]phenyl]propyl]piperidine |
|---|---|
| PubChem CID | 118102539 |
| Molecular Formula | C36H56N2 |
| Molecular Weight | 516.86 g/mol |
| Exact Mass | 516.44 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-[3-[4-[4-[3-(2,2,6,6-tetramethylpiperidin-4-yl)propyl]phenyl]phenyl]propyl]piperidine |
| SMILES | CC1(C)CC(CCCc2ccc(-c3ccc(CCCC4CC(C)(C)NC(C)(C)C4)cc3)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C36H56N2/c1-33(2)23-29(24-34(3,4)37-33)13-9-11-27-15-19-31(20-16-27)32-21-17-28(18-22-32)12-10-14-30-25-35(5,6)38-36(7,8)26-30/h15-22,29-30,37-38H,9-14,23-26H2,1-8H3 |
| InChIKey | CCWWUUYGLJIHKG-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.86 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |