C15H19BN2O4 — CID 10590442
[4-[3-(6,8-dioxo-5,7-diazaspiro[3.4]octan-2-yl)propyl]phenyl]boronic acid (PubChem CID 10590442) has the molecular formula C15H19BN2O4 and a molecular weight of 302.14 g/mol. Its IUPAC name is [4-[3-(6,8-dioxo-5,7-diazaspiro[3.4]octan-2-yl)propyl]phenyl]boronic acid.
| Compound Name | [4-[3-(6,8-dioxo-5,7-diazaspiro[3.4]octan-2-yl)propyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 10590442 |
| Molecular Formula | C15H19BN2O4 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | [4-[3-(6,8-dioxo-5,7-diazaspiro[3.4]octan-2-yl)propyl]phenyl]boronic acid |
| SMILES | O=C1NC(=O)C2(CC(CCCc3ccc(B(O)O)cc3)C2)N1 |
| InChI | InChI=1S/C15H19BN2O4/c19-13-15(18-14(20)17-13)8-11(9-15)3-1-2-10-4-6-12(7-5-10)16(21)22/h4-7,11,21-22H,1-3,8-9H2,(H2,17,18,19,20) |
| InChIKey | FDGZZWQOZBGGJK-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|