C12H14N2O3 — CID 140970561
5-[3-(4-hydroxyphenyl)propyl]imidazolidine-2,4-dione (PubChem CID 140970561) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 5-[3-(4-hydroxyphenyl)propyl]imidazolidine-2,4-dione.
| Compound Name | 5-[3-(4-hydroxyphenyl)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140970561 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 5-[3-(4-hydroxyphenyl)propyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CCCc2ccc(O)cc2)N1 |
| InChI | InChI=1S/C12H14N2O3/c15-9-6-4-8(5-7-9)2-1-3-10-11(16)14-12(17)13-10/h4-7,10,15H,1-3H2,(H2,13,14,16,17) |
| InChIKey | VWCBIXSBKJCQFD-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|