C8H12N2O3 — CID 175318269
5-[3-(oxiran-2-yl)propyl]imidazolidine-2,4-dione (PubChem CID 175318269) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 5-[3-(oxiran-2-yl)propyl]imidazolidine-2,4-dione.
| Compound Name | 5-[3-(oxiran-2-yl)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 175318269 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 5-[3-(oxiran-2-yl)propyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CCCC2CO2)N1 |
| InChI | InChI=1S/C8H12N2O3/c11-7-6(9-8(12)10-7)3-1-2-5-4-13-5/h5-6H,1-4H2,(H2,9,10,11,12) |
| InChIKey | ZKWTWXIMBTWSDC-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|