C18H16N4O6 — CID 159859205
5-(4-hydroxyphenyl)imidazolidine-2,4-dione (PubChem CID 159859205) has the molecular formula C18H16N4O6 and a molecular weight of 384.35 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 5-(4-hydroxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 159859205 |
| Molecular Formula | C18H16N4O6 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 5-(4-hydroxyphenyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2ccc(O)cc2)N1.O=C1NC(=O)C(c2ccc(O)cc2)N1 |
| InChI | InChI=1S/2C9H8N2O3/c2*12-6-3-1-5(2-4-6)7-8(13)11-9(14)10-7/h2*1-4,7,12H,(H2,10,11,13,14) |
| InChIKey | NQXNAMMDTYLGIJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|