About 5-(4-hydroxyphenyl)imidazolidine-2,4-dione
5-(4-hydroxyphenyl)imidazolidine-2,4-dione (PubChem CID 159859205) has the molecular formula C18H16N4O6
and a molecular weight of 384.35 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(4-hydroxyphenyl)imidazolidine-2,4-dione |
| PubChem CID | 159859205 |
| Molecular Formula | C18H16N4O6 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 5-(4-hydroxyphenyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2ccc(O)cc2)N1.O=C1NC(=O)C(c2ccc(O)cc2)N1 |
| InChI | InChI=1S/2C9H8N2O3/c2*12-6-3-1-5(2-4-6)7-8(13)11-9(14)10-7/h2*1-4,7,12H,(H2,10,11,13,14) |
| InChIKey | NQXNAMMDTYLGIJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-hydroxyphenyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-hydroxyphenyl)imidazolidine-2,4-dione?
The IUPAC name of 5-(4-hydroxyphenyl)imidazolidine-2,4-dione (CID 159859205) is 5-(4-hydroxyphenyl)imidazolidine-2,4-dione.
What is the SMILES notation for 5-(4-hydroxyphenyl)imidazolidine-2,4-dione?
The canonical SMILES for 5-(4-hydroxyphenyl)imidazolidine-2,4-dione is O=C1NC(=O)C(c2ccc(O)cc2)N1.O=C1NC(=O)C(c2ccc(O)cc2)N1.
What is the InChIKey of 5-(4-hydroxyphenyl)imidazolidine-2,4-dione?
The InChIKey is NQXNAMMDTYLGIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H8N2O3/c2*12-6-3-1-5(2-4-6)7-8(13)11-9(14)10-7/h2*1-4,7,12H,(H2,10,11,13,14).
What are the key properties of 5-(4-hydroxyphenyl)imidazolidine-2,4-dione?
5-(4-hydroxyphenyl)imidazolidine-2,4-dione has a molecular weight of 384.35 g/mol, XLogP of 0.55, 2 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-hydroxyphenyl)imidazolidine-2,4-dione is sourced from PubChem (CID 159859205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).