C11H12N2O3 — CID 708719
(5S)-5-(4-ethoxyphenyl)imidazolidine-2,4-dione (PubChem CID 708719) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is (5S)-5-(4-ethoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(4-ethoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 708719 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (5S)-5-(4-ethoxyphenyl)imidazolidine-2,4-dione |
| SMILES | CCOc1ccc([C@@H]2NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C11H12N2O3/c1-2-16-8-5-3-7(4-6-8)9-10(14)13-11(15)12-9/h3-6,9H,2H2,1H3,(H2,12,13,14,15)/t9-/m0/s1 |
| InChIKey | ZURKIBNDQWNNDN-VIFPVBQESA-N |
| XLogP | 0.97 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|