C12H14N2O5 — CID 141182500
(5R)-5-[4-(1,3-dihydroxypropan-2-yloxy)phenyl]imidazolidine-2,4-dione (PubChem CID 141182500) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is (5R)-5-[4-(1,3-dihydroxypropan-2-yloxy)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[4-(1,3-dihydroxypropan-2-yloxy)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 141182500 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (5R)-5-[4-(1,3-dihydroxypropan-2-yloxy)phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@@H](c2ccc(OC(CO)CO)cc2)N1 |
| InChI | InChI=1S/C12H14N2O5/c15-5-9(6-16)19-8-3-1-7(2-4-8)10-11(17)14-12(18)13-10/h1-4,9-10,15-16H,5-6H2,(H2,13,14,17,18)/t10-/m1/s1 |
| InChIKey | ATYYQXYDLMEFHU-SNVBAGLBSA-N |
| XLogP | -0.70 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|