C9H9BN2O4 — CID 99773063
[4-[(4S)-2,5-dioxoimidazolidin-4-yl]phenyl]boronic acid (PubChem CID 99773063) has the molecular formula C9H9BN2O4 and a molecular weight of 219.99 g/mol. Its IUPAC name is [4-[(4S)-2,5-dioxoimidazolidin-4-yl]phenyl]boronic acid.
| Compound Name | [4-[(4S)-2,5-dioxoimidazolidin-4-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 99773063 |
| Molecular Formula | C9H9BN2O4 |
| Molecular Weight | 219.99 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | [4-[(4S)-2,5-dioxoimidazolidin-4-yl]phenyl]boronic acid |
| SMILES | O=C1NC(=O)[C@H](c2ccc(B(O)O)cc2)N1 |
| InChI | InChI=1S/C9H9BN2O4/c13-8-7(11-9(14)12-8)5-1-3-6(4-2-5)10(15)16/h1-4,7,15-16H,(H2,11,12,13,14)/t7-/m0/s1 |
| InChIKey | SBVZPLAXWAZNFU-ZETCQYMHSA-N |
| XLogP | -1.75 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.99 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|