C14H15BN2O4 — CID 102096907
[4-(2,5-dioxo-1,3,4,6,7,8-hexahydroquinazolin-4-yl)phenyl]boronic acid (PubChem CID 102096907) has the molecular formula C14H15BN2O4 and a molecular weight of 286.10 g/mol. Its IUPAC name is [4-(2,5-dioxo-1,3,4,6,7,8-hexahydroquinazolin-4-yl)phenyl]boronic acid.
| Compound Name | [4-(2,5-dioxo-1,3,4,6,7,8-hexahydroquinazolin-4-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 102096907 |
| Molecular Formula | C14H15BN2O4 |
| Molecular Weight | 286.10 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | [4-(2,5-dioxo-1,3,4,6,7,8-hexahydroquinazolin-4-yl)phenyl]boronic acid |
| SMILES | O=C1NC2=C(C(=O)CCC2)C(c2ccc(B(O)O)cc2)N1 |
| InChI | InChI=1S/C14H15BN2O4/c18-11-3-1-2-10-12(11)13(17-14(19)16-10)8-4-6-9(7-5-8)15(20)21/h4-7,13,20-21H,1-3H2,(H2,16,17,19) |
| InChIKey | KPLGUTFDMHITFQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.10 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|