C11H16N2O2 — CID 86037433
4-propan-2-yl-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione (PubChem CID 86037433) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-propan-2-yl-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione.
| Compound Name | 4-propan-2-yl-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 86037433 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 4-propan-2-yl-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
| SMILES | CC(C)C1NC(=O)NC2=C1C(=O)CCC2 |
| InChI | InChI=1S/C11H16N2O2/c1-6(2)10-9-7(12-11(15)13-10)4-3-5-8(9)14/h6,10H,3-5H2,1-2H3,(H2,12,13,15) |
| InChIKey | DXCIREUGHSHLNY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |