C15H16N2O3 — CID 853727
(4S)-4-phenylmethoxy-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione (PubChem CID 853727) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is (4S)-4-phenylmethoxy-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione.
| Compound Name | (4S)-4-phenylmethoxy-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
|---|---|
| PubChem CID | 853727 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (4S)-4-phenylmethoxy-1,3,4,6,7,8-hexahydroquinazoline-2,5-dione |
| SMILES | O=C1NC2=C(C(=O)CCC2)[C@H](OCc2ccccc2)N1 |
| InChI | InChI=1S/C15H16N2O3/c18-12-8-4-7-11-13(12)14(17-15(19)16-11)20-9-10-5-2-1-3-6-10/h1-3,5-6,14H,4,7-9H2,(H2,16,17,19)/t14-/m0/s1 |
| InChIKey | QZWOTERXMCEQQI-AWEZNQCLSA-N |
| XLogP | 1.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |