C11H14N2O2 — CID 15249926
(3aS,8bS)-8b-methyl-3,3a,4,5,6,7-hexahydro-1H-pyrrolo[2,3-b]indole-2,8-dione (PubChem CID 15249926) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is (3aS,8bS)-8b-methyl-3,3a,4,5,6,7-hexahydro-1H-pyrrolo[2,3-b]indole-2,8-dione.
| Compound Name | (3aS,8bS)-8b-methyl-3,3a,4,5,6,7-hexahydro-1H-pyrrolo[2,3-b]indole-2,8-dione |
|---|---|
| PubChem CID | 15249926 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (3aS,8bS)-8b-methyl-3,3a,4,5,6,7-hexahydro-1H-pyrrolo[2,3-b]indole-2,8-dione |
| SMILES | C[C@@]12CC(=O)N[C@@H]1NC1=C2C(=O)CCC1 |
| InChI | InChI=1S/C11H14N2O2/c1-11-5-8(15)13-10(11)12-6-3-2-4-7(14)9(6)11/h10,12H,2-5H2,1H3,(H,13,15)/t10-,11-/m0/s1 |
| InChIKey | LGKLCEAVRMWTJG-QWRGUYRKSA-N |
| XLogP | 0.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |