C10H15NO2 — CID 130951224
(2S,3R)-3-hydroxy-2-methyl-2,3,4,6,7,8-hexahydro-1H-quinolin-5-one (PubChem CID 130951224) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-methyl-2,3,4,6,7,8-hexahydro-1H-quinolin-5-one.
| Compound Name | (2S,3R)-3-hydroxy-2-methyl-2,3,4,6,7,8-hexahydro-1H-quinolin-5-one |
|---|---|
| PubChem CID | 130951224 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-methyl-2,3,4,6,7,8-hexahydro-1H-quinolin-5-one |
| SMILES | C[C@@H]1NC2=C(C[C@H]1O)C(=O)CCC2 |
| InChI | InChI=1S/C10H15NO2/c1-6-10(13)5-7-8(11-6)3-2-4-9(7)12/h6,10-11,13H,2-5H2,1H3/t6-,10+/m0/s1 |
| InChIKey | LBYOYVKCUFCKFY-QUBYGPBYSA-N |
| XLogP | 0.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |