C7H15NO2 — CID 159095548
(4R,5S)-4,5-dimethylpyrrolidin-2-one;methanol (PubChem CID 159095548) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is (4R,5S)-4,5-dimethylpyrrolidin-2-one;methanol.
| Compound Name | (4R,5S)-4,5-dimethylpyrrolidin-2-one;methanol |
|---|---|
| PubChem CID | 159095548 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | (4R,5S)-4,5-dimethylpyrrolidin-2-one;methanol |
| SMILES | CO.C[C@@H]1CC(=O)N[C@H]1C |
| InChI | InChI=1S/C6H11NO.CH4O/c1-4-3-6(8)7-5(4)2;1-2/h4-5H,3H2,1-2H3,(H,7,8);2H,1H3/t4-,5+;/m1./s1 |
| InChIKey | KCPSQRIJXIIANM-JBUOLDKXSA-N |
| XLogP | 0.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |