C8H17NO — CID 143653948
(4S,5S)-4,5-dimethylpyrrolidin-2-one;ethane (PubChem CID 143653948) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is (4S,5S)-4,5-dimethylpyrrolidin-2-one;ethane.
| Compound Name | (4S,5S)-4,5-dimethylpyrrolidin-2-one;ethane |
|---|---|
| PubChem CID | 143653948 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (4S,5S)-4,5-dimethylpyrrolidin-2-one;ethane |
| SMILES | CC.C[C@@H]1NC(=O)C[C@@H]1C |
| InChI | InChI=1S/C6H11NO.C2H6/c1-4-3-6(8)7-5(4)2;1-2/h4-5H,3H2,1-2H3,(H,7,8);1-2H3/t4-,5-;/m0./s1 |
| InChIKey | BFLHGVHEOMCEHN-FHAQVOQBSA-N |
| XLogP | 1.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |