C5H9NOS — CID 11815391
(4R,5R)-5-methyl-4-sulfanylpyrrolidin-2-one (PubChem CID 11815391) has the molecular formula C5H9NOS and a molecular weight of 131.20 g/mol. Its IUPAC name is (4R,5R)-5-methyl-4-sulfanylpyrrolidin-2-one.
| Compound Name | (4R,5R)-5-methyl-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 11815391 |
| Molecular Formula | C5H9NOS |
| Molecular Weight | 131.20 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | (4R,5R)-5-methyl-4-sulfanylpyrrolidin-2-one |
| SMILES | C[C@H]1NC(=O)C[C@H]1S |
| InChI | InChI=1S/C5H9NOS/c1-3-4(8)2-5(7)6-3/h3-4,8H,2H2,1H3,(H,6,7)/t3-,4-/m1/s1 |
| InChIKey | OYQNNYFLDYZDPB-QWWZWVQMSA-N |
| XLogP | 0.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.20 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|