C5H10N2OS — CID 75088843
2-methyl-6-sulfanyl-1,3-diazinan-4-one (PubChem CID 75088843) has the molecular formula C5H10N2OS and a molecular weight of 146.21 g/mol. Its IUPAC name is 2-methyl-6-sulfanyl-1,3-diazinan-4-one.
| Compound Name | 2-methyl-6-sulfanyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 75088843 |
| Molecular Formula | C5H10N2OS |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 2-methyl-6-sulfanyl-1,3-diazinan-4-one |
| SMILES | CC1NC(=O)CC(S)N1 |
| InChI | InChI=1S/C5H10N2OS/c1-3-6-4(8)2-5(9)7-3/h3,5,7,9H,2H2,1H3,(H,6,8) |
| InChIKey | DVSUQHGRRULHGC-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|