About 3,7-dimethyl-1,4-diazepan-5-one
3,7-dimethyl-1,4-diazepan-5-one (PubChem CID 55287243) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 3,7-dimethyl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 3,7-dimethyl-1,4-diazepan-5-one |
| PubChem CID | 55287243 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 3,7-dimethyl-1,4-diazepan-5-one |
| SMILES | CC1CC(=O)NC(C)CN1 |
| InChI | InChI=1S/C7H14N2O/c1-5-3-7(10)9-6(2)4-8-5/h5-6,8H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | QWMBDSGOVKTPEX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,7-dimethyl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-1,4-diazepan-5-one?
The IUPAC name of 3,7-dimethyl-1,4-diazepan-5-one (CID 55287243) is 3,7-dimethyl-1,4-diazepan-5-one.
What is the SMILES notation for 3,7-dimethyl-1,4-diazepan-5-one?
The canonical SMILES for 3,7-dimethyl-1,4-diazepan-5-one is CC1CC(=O)NC(C)CN1.
What is the InChIKey of 3,7-dimethyl-1,4-diazepan-5-one?
The InChIKey is QWMBDSGOVKTPEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O/c1-5-3-7(10)9-6(2)4-8-5/h5-6,8H,3-4H2,1-2H3,(H,9,10).
What are the key properties of 3,7-dimethyl-1,4-diazepan-5-one?
3,7-dimethyl-1,4-diazepan-5-one has a molecular weight of 142.20 g/mol, XLogP of -0.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-1,4-diazepan-5-one is sourced from PubChem (CID 55287243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).