About 2,5-dimethylpiperazine;methanethiol
2,5-dimethylpiperazine;methanethiol (PubChem CID 170737896) has the molecular formula C7H18N2S
and a molecular weight of 162.30 g/mol. Its IUPAC name is 2,5-dimethylpiperazine;methanethiol.
Molecular Properties
| Compound Name | 2,5-dimethylpiperazine;methanethiol |
| PubChem CID | 170737896 |
| Molecular Formula | C7H18N2S |
| Molecular Weight | 162.30 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2,5-dimethylpiperazine;methanethiol |
| SMILES | CC1CNC(C)CN1.CS |
| InChI | InChI=1S/C6H14N2.CH4S/c1-5-3-8-6(2)4-7-5;1-2/h5-8H,3-4H2,1-2H3;2H,1H3 |
| InChIKey | JVWSADSPWOFKMA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethylpiperazine;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylpiperazine;methanethiol?
The IUPAC name of 2,5-dimethylpiperazine;methanethiol (CID 170737896) is 2,5-dimethylpiperazine;methanethiol.
What is the SMILES notation for 2,5-dimethylpiperazine;methanethiol?
The canonical SMILES for 2,5-dimethylpiperazine;methanethiol is CC1CNC(C)CN1.CS.
What is the InChIKey of 2,5-dimethylpiperazine;methanethiol?
The InChIKey is JVWSADSPWOFKMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.CH4S/c1-5-3-8-6(2)4-7-5;1-2/h5-8H,3-4H2,1-2H3;2H,1H3.
What are the key properties of 2,5-dimethylpiperazine;methanethiol?
2,5-dimethylpiperazine;methanethiol has a molecular weight of 162.30 g/mol, XLogP of 0.50, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylpiperazine;methanethiol is sourced from PubChem (CID 170737896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).